EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84212 - furan-2,5-dicarboxylic acid
| Formula | C6H4O5 |
| Net Charge | 0 |
| Average Mass | 156.093 |
| Monoisotopic Mass | 156.00587 |
| SMILES | O=C(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C6H4O5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10) |
| InChIKey | CHTHALBTIRVDBM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24271187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furan-2,5-dicarboxylic acid (CHEBI:84212) has role human urinary metabolite (CHEBI:84087) |
| furan-2,5-dicarboxylic acid (CHEBI:84212) is a dicarboxylic acid (CHEBI:35692) |
| furan-2,5-dicarboxylic acid (CHEBI:84212) is a furans (CHEBI:24129) |
| furan-2,5-dicarboxylic acid (CHEBI:84212) is conjugate acid of furan-2,5-dicarboxylate (CHEBI:83389) |
| Incoming Relation(s) |
| furan-2,5-dicarboxylate (CHEBI:83389) is conjugate base of furan-2,5-dicarboxylic acid (CHEBI:84212) |
| IUPAC Name |
|---|
| furan-2,5-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 2,5-dicarboxyfuran | MetaCyc |
| Dehydromucic acid | HMDB |
| Furane-alpha,alpha'-dicarboxylic acid | ChemIDplus |
| 2,5-Furandicarboxylic acid | ChemIDplus |
| furane-α,α'-dicarboxylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| CPD-14105 | MetaCyc |
| HMDB0004812 | HMDB |
| 2,5-Furandicarboxylic_acid | Wikipedia |
| Citations |
|---|