EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N7O18P3SR |
| Net Charge | -4 |
| Average Mass (excl. R groups) | 821.540 |
| Monoisotopic Mass (excl. R groups) | 821.08939 |
| SMILES | CC(C)(COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-])[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)*CO |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) is a fatty acyl-CoA(4−) (CHEBI:77636) |
| ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) is conjugate base of ω-hydroxy fatty acyl-CoA (CHEBI:85212) |
| Incoming Relation(s) |
| (11Z)-18-hydroxyoctadecenoyl-CoA(4−) (CHEBI:84902) is a ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) |
| (9Z,12Z)-18-hydroxyoctadecadienoyl-CoA(4−) (CHEBI:84904) is a ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) |
| 15-hydroxypentadecanoyl-CoA(4−) (CHEBI:84205) is a ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) |
| 16-hydroxyhexadecanoyl-CoA(4−) (CHEBI:84207) is a ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) |
| 18-hydroxyoleoyl-CoA(4−) (CHEBI:86044) is a ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) |
| ω-hydroxy fatty acyl-CoA (CHEBI:85212) is conjugate acid of ω-hydroxy fatty acyl-CoA(4−) (CHEBI:84204) |
| Synonym | Source |
|---|---|
| ω-hydroxy fatty acyl-coenzyme A(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| ω-hydroxy fatty acyl-CoA | UniProt |