EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8ClNO2 |
| Net Charge | 0 |
| Average Mass | 221.643 |
| Monoisotopic Mass | 221.02436 |
| SMILES | Cc1cnc2c(C(=O)O)c(Cl)ccc2c1 |
| InChI | InChI=1S/C11H8ClNO2/c1-6-4-7-2-3-8(12)9(11(14)15)10(7)13-5-6/h2-5H,1H3,(H,14,15) |
| InChIKey | ALZOLUNSQWINIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinmerac (CHEBI:84199) has role environmental contaminant (CHEBI:78298) |
| quinmerac (CHEBI:84199) has role herbicide (CHEBI:24527) |
| quinmerac (CHEBI:84199) has role synthetic auxin (CHEBI:26841) |
| quinmerac (CHEBI:84199) is a organochlorine compound (CHEBI:36683) |
| quinmerac (CHEBI:84199) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| IUPAC Name |
|---|
| 7-chloro-3-methylquinoline-8-carboxylic acid |
| Synonyms | Source |
|---|---|
| 7-Chloro-3-methyl-8-quinolinecarboxylic acid | ChemIDplus |
| BAS 518 | ChemIDplus |
| Citations |
|---|