EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23O2 |
| Net Charge | -1 |
| Average Mass | 199.314 |
| Monoisotopic Mass | 199.17035 |
| SMILES | CCCCCCCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C12H24O2/c1-3-4-5-6-7-8-9-11(2)10-12(13)14/h11H,3-10H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | SHTJBHFHMAKAPT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylundecanoate (CHEBI:84184) is a 3-methyl fatty acid anion (CHEBI:83972) |
| 3-methylundecanoate (CHEBI:84184) is a fatty acid anion 12:0 (CHEBI:78119) |
| 3-methylundecanoate (CHEBI:84184) is a medium-chain fatty acid anion (CHEBI:59558) |
| 3-methylundecanoate (CHEBI:84184) is conjugate base of 3-methylundecanoic acid (CHEBI:85059) |
| Incoming Relation(s) |
| 3-methylundecanoic acid (CHEBI:85059) is conjugate acid of 3-methylundecanoate (CHEBI:84184) |
| IUPAC Name |
|---|
| 3-methylundecanoate |
| Synonym | Source |
|---|---|
| 3-methylundecanoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-methylundecanoate | UniProt |
| Citations |
|---|