EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H54N8O10 |
| Net Charge | 0 |
| Average Mass | 866.973 |
| Monoisotopic Mass | 866.39629 |
| SMILES | CC[C@H]1NC(=O)[C@@H](NC(=O)c2ncccc2O)[C@@H](C)OC(=O)[C@H](c2ccccc2)NC(=O)[C@@H]2CC(=O)CCN2C(=O)[C@H](Cc2ccc(N(C)C)cc2)N(C)C(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C45H54N8O10/c1-6-31-42(59)52-22-11-14-32(52)43(60)51(5)34(24-27-16-18-29(19-17-27)50(3)4)44(61)53-23-20-30(54)25-33(53)39(56)49-37(28-12-8-7-9-13-28)45(62)63-26(2)36(40(57)47-31)48-41(58)38-35(55)15-10-21-46-38/h7-10,12-13,15-19,21,26,31-34,36-37,55H,6,11,14,20,22-25H2,1-5H3,(H,47,57)(H,48,58)(H,49,56)/t26-,31-,32+,33+,34+,36+,37+/m1/s1 |
| InChIKey | YGXCETJZBDTKRY-DZCVGBHJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces pristinaespiralis (ncbitaxon:38300) | - | PubMed (25708513) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pristinamycin IA (CHEBI:8417) has role antibacterial drug (CHEBI:36047) |
| pristinamycin IA (CHEBI:8417) has role antimicrobial agent (CHEBI:33281) |
| pristinamycin IA (CHEBI:8417) has role bacterial metabolite (CHEBI:76969) |
| pristinamycin IA (CHEBI:8417) is a cyclodepsipeptide (CHEBI:35213) |
| Incoming Relation(s) |
| pristinamycin (CHEBI:85274) has part pristinamycin IA (CHEBI:8417) |
| IUPAC Name |
|---|
| N-[(6R,9S,10R,13S,15aS,22S,24aS)-22-{[4-(dimethylamino)phenyl]methyl}-6-ethyl-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyldocosahydro-12H-pyrido[2,1-f]pyrrolo[2,1-l][1,4,7,10,13,16]oxapentaazacyclononadecin-9-yl]-3-hydroxypyridine-2-carboxamide |
| Synonyms | Source |
|---|---|
| 4-[4-(Dimethylamino)-N-methyl-L-phenylalanine]virginiamycin S1 | KEGG COMPOUND |
| Antibiotic PA 114B | KNApSAcK |
| Antibiotic PA 114B1 | KNApSAcK |
| Mikamycin B | KEGG COMPOUND |
| Mikamycin B | KNApSAcK |
| NSC 92554 | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00018680 | KNApSAcK |
| C11615 | KEGG COMPOUND |
| Pristinamycin_IA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78387 | Reaxys |
| CAS:3131-03-1 | KEGG COMPOUND |
| CAS:3131-03-1 | ChemIDplus |