EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45O8P |
| Net Charge | 0 |
| Average Mass | 480.579 |
| Monoisotopic Mass | 480.28521 |
| SMILES | CCCCCCCCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C23H45O8P/c1-3-5-7-9-11-13-15-17-22(24)29-19-21(20-30-32(26,27)28)31-23(25)18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3,(H2,26,27,28) |
| InChIKey | PHQFPHNJHDEXLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didecanoylphosphatidic acid (CHEBI:84164) is a decanoate ester (CHEBI:87658) |
| didecanoylphosphatidic acid (CHEBI:84164) is a phosphatidic acid (CHEBI:16337) |
| didecanoylphosphatidic acid (CHEBI:84164) is conjugate acid of didecanoylphosphatidate(2−) (CHEBI:83278) |
| Incoming Relation(s) |
| didecanoylphosphatidate(2−) (CHEBI:83278) is conjugate base of didecanoylphosphatidic acid (CHEBI:84164) |
| IUPAC Name |
|---|
| 3-(phosphonooxy)propane-1,2-diyl didecanoate |
| Synonym | Source |
|---|---|
| 1,2-didecanoylglycero-3-phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2487592 | Reaxys |