EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | CCCCCC1=CC(=O)C=C(OC)C1=O |
| InChI | InChI=1S/C12H16O3/c1-3-4-5-6-9-7-10(13)8-11(15-2)12(9)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | WLWIMKWZMGJRBS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryosphaeria mamane (ncbitaxon:144557) | - | PubMed (17827773) | Endophytic fungus Strain: PSU M76 |
| Miconia (ncbitaxon:263288) | - | PubMed (11170656) | |
| Miconia eriodonta (IPNI:159047-2) | - | DOI (10.1021/np50069a029) | |
| Miconia lepidota (ncbitaxon:477087) | - | PubMed (11170656) | |
| Primula obconica (ncbitaxon:170924) | - | Article (BEIBLATT VIERTELJAHR NATURFORSCH GES ZURICH,1927,13,1) |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primin (CHEBI:8413) has role allergen (CHEBI:50904) |
| primin (CHEBI:8413) has role antifeedant (CHEBI:22583) |
| primin (CHEBI:8413) has role antimicrobial agent (CHEBI:33281) |
| primin (CHEBI:8413) has role hapten (CHEBI:59174) |
| primin (CHEBI:8413) has role metabolite (CHEBI:25212) |
| primin (CHEBI:8413) is a 1,4-benzoquinones (CHEBI:132124) |
| IUPAC Name |
|---|
| 2-methoxy-6-pentyl-1,4-benzoquinone |
| Synonyms | Source |
|---|---|
| 2-methoxy-6-n-pentyl-1,4-benzoquinone | ChEBI |
| 2-methoxy-6-n-pentyl-p-benzoquinone | ChemIDplus |
| 2-methoxy-6-pentyl-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| 2-methoxy-6-pentylcyclohexa-2,5-diene-1,4-dione | IUPAC |
| Primin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1961495 | Reaxys |
| CAS:15121-94-5 | ChemIDplus |
| CAS:15121-94-5 | KEGG COMPOUND |
| Citations |
|---|