EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | CCCCCC1=CC(=O)C=C(OC)C1=O |
| InChI | InChI=1S/C12H16O3/c1-3-4-5-6-9-7-10(13)8-11(15-2)12(9)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | WLWIMKWZMGJRBS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryosphaeria mamane (ncbitaxon:144557) | - | PubMed (17827773) | Endophytic fungus Strain: PSU M76 |
| Miconia eriodonta (IPNI:159047-2) | - | DOI (10.1021/np50069a029) | |
| Miconia lepidota (ncbitaxon:477087) | - | PubMed (11170656) | |
| Primula obconica (ncbitaxon:170924) | - | Article (BEIBLATT VIERTELJAHR NATURFORSCH GES ZURICH,1927,13,1) | |
| Miconia (ncbitaxon:263288) | - | PubMed (11170656) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primin (CHEBI:8413) has role allergen (CHEBI:50904) |
| primin (CHEBI:8413) has role antifeedant (CHEBI:22583) |
| primin (CHEBI:8413) has role antimicrobial agent (CHEBI:33281) |
| primin (CHEBI:8413) has role hapten (CHEBI:59174) |
| primin (CHEBI:8413) has role metabolite (CHEBI:25212) |
| primin (CHEBI:8413) is a 1,4-benzoquinones (CHEBI:132124) |
| IUPAC Name |
|---|
| 2-methoxy-6-pentyl-1,4-benzoquinone |
| Synonyms | Source |
|---|---|
| Primin | KEGG COMPOUND |
| 2-methoxy-6-n-pentyl-p-benzoquinone | ChemIDplus |
| 2-methoxy-6-pentyl-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| 2-methoxy-6-n-pentyl-1,4-benzoquinone | ChEBI |
| 2-methoxy-6-pentylcyclohexa-2,5-diene-1,4-dione | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1961495 | Reaxys |
| CAS:15121-94-5 | KEGG COMPOUND |
| CAS:15121-94-5 | ChemIDplus |
| Citations |
|---|