EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | CCC1(c2ccccc2)C(=O)NCNC1=O |
| InChI | InChI=1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | DQMZLTXERSFNPB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primidone (CHEBI:8412) has role anticonvulsant (CHEBI:35623) |
| primidone (CHEBI:8412) has role environmental contaminant (CHEBI:78298) |
| primidone (CHEBI:8412) has role xenobiotic (CHEBI:35703) |
| primidone (CHEBI:8412) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 5-ethyl-5-phenyldihydropyrimidine-4,6(1H,5H)-dione |
| INNs | Source |
|---|---|
| primidona | ChemIDplus |
| primidone | ChemIDplus |
| primidonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-deoxyphenobarbital | ChemIDplus |
| 5-Phenyl-5-ethyl-Hexahydropyrimidine-4,6-dione | KEGG COMPOUND |
| NSC-41701 | ChEMBL |
| Resimatil | ChEMBL |
| Brand Names | Source |
|---|---|
| Lepsiral | ChEMBL |
| Liskantin | ChEMBL |
| Mysoline | ChEMBL |
| Citations |
|---|