EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3 |
| Net Charge | 0 |
| Average Mass | 265.360 |
| Monoisotopic Mass | 265.15790 |
| SMILES | c1ccc(CN(CC2=NCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,18,19) |
| InChIKey | REYFJDPCWQRWAA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antazoline (CHEBI:84115) has role cholinergic antagonist (CHEBI:48873) |
| antazoline (CHEBI:84115) has role H1-receptor antagonist (CHEBI:37955) |
| antazoline (CHEBI:84115) has role xenobiotic (CHEBI:35703) |
| antazoline (CHEBI:84115) is a aromatic amine (CHEBI:33860) |
| antazoline (CHEBI:84115) is a imidazolines (CHEBI:53095) |
| antazoline (CHEBI:84115) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| INNs | Source |
|---|---|
| antazolina | ChemIDplus |
| antazoline | ChemIDplus |
| antazoline | KEGG DRUG |
| antazolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(N-Benzylanilinomethyl)-2-imidazoline | ChemIDplus |
| 2-(N-Phenyl-N-benzylaminomethyl)imidazoline | ChemIDplus |
| 4,5-Dihydro-N-phenyl-N-phenylmethyl-1H-imidazole-2-methanamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 224 | DrugCentral |
| Antazoline | Wikipedia |
| D07458 | KEGG DRUG |
| DB08799 | DrugBank |
| HMDB0015689 | HMDB |
| LSM-6023 | LINCS |
| Citations |
|---|