EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84115 - antazoline
| Formula | C17H19N3 |
| Net Charge | 0 |
| Average Mass | 265.360 |
| Monoisotopic Mass | 265.15790 |
| SMILES | c1ccc(CN(CC2=NCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,18,19) |
| InChIKey | REYFJDPCWQRWAA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antazoline (CHEBI:84115) has role cholinergic antagonist (CHEBI:48873) |
| antazoline (CHEBI:84115) has role H1-receptor antagonist (CHEBI:37955) |
| antazoline (CHEBI:84115) has role xenobiotic (CHEBI:35703) |
| antazoline (CHEBI:84115) is a aromatic amine (CHEBI:33860) |
| antazoline (CHEBI:84115) is a imidazolines (CHEBI:53095) |
| antazoline (CHEBI:84115) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| INNs | Source |
|---|---|
| antazolina | ChemIDplus |
| antazoline | ChemIDplus |
| antazoline | KEGG DRUG |
| antazolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(N-Benzylanilinomethyl)-2-imidazoline | ChemIDplus |
| 2-(N-Phenyl-N-benzylaminomethyl)imidazoline | ChemIDplus |
| 4,5-Dihydro-N-phenyl-N-phenylmethyl-1H-imidazole-2-methanamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 224 | DrugCentral |
| Antazoline | Wikipedia |
| D07458 | KEGG DRUG |
| DB08799 | DrugBank |
| HMDB0015689 | HMDB |
| LSM-6023 | LINCS |
| Citations |
|---|