EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | O=c1cc(-c2ccccc2)oc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C15H10O4/c16-10-6-7-11(17)15-14(10)12(18)8-13(19-15)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | KYLWJAUHHPTDDH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Primula mistassinica (ncbitaxon:159011) | - | PubMed (6660907) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primetin (CHEBI:8410) has role plant metabolite (CHEBI:76924) |
| primetin (CHEBI:8410) is a dihydroxyflavone (CHEBI:38686) |
| IUPAC Name |
|---|
| 5,8-dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5,8-Dihydroxyflavone | KEGG COMPOUND |
| Citations |
|---|