EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COC(=O)/C=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C10H10O4/c1-14-10(13)5-2-7-6-8(11)3-4-9(7)12/h2-6,11-12H,1H3/b5-2+ |
| InChIKey | BQCNSTFWSKOWMA-GORDUTHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Grevillea robusta (ncbitaxon:105748) | leaf (BTO:0000713) | PubMed (22064272) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role geroprotector (CHEBI:176497) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role human urinary metabolite (CHEBI:84087) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role plant metabolite (CHEBI:76924) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) is a cinnamate ester (CHEBI:36087) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) is a hydroquinones (CHEBI:24646) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (2E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| erbstatin analog | LINCS |
| methyl 2,5-dihydroxycinnamate | ChEBI |
| methyl 3-(2,5-dihydroxyphenyl)-2-propenoate | ChemIDplus |
| methyl 3-(2',5'dihydroxyphenyl)acrylate | ChEBI |
| methyl 3-(2,5-dihydroxyphenyl)acrylate | LINCS |
| methyl grevillate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4510151 | ChemSpider |
| HMDB0061686 | HMDB |
| LSM-43038 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8140004 | Reaxys |
| CAS:63177-57-1 | ChemIDplus |
| Citations |
|---|