EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COC(=O)/C=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C10H10O4/c1-14-10(13)5-2-7-6-8(11)3-4-9(7)12/h2-6,11-12H,1H3/b5-2+ |
| InChIKey | BQCNSTFWSKOWMA-GORDUTHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Grevillea robusta (ncbitaxon:105748) | leaf (BTO:0000713) | PubMed (22064272) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role geroprotector (CHEBI:176497) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role human urinary metabolite (CHEBI:84087) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) has role plant metabolite (CHEBI:76924) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) is a cinnamate ester (CHEBI:36087) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) is a hydroquinones (CHEBI:24646) |
| 2,5-dihydroxycinnamic acid methyl ester (CHEBI:84089) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (2E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| erbstatin analog | LINCS |
| methyl 2,5-dihydroxycinnamate | ChEBI |
| methyl 3-(2,5-dihydroxyphenyl)-2-propenoate | ChemIDplus |
| methyl 3-(2',5'dihydroxyphenyl)acrylate | ChEBI |
| methyl 3-(2,5-dihydroxyphenyl)acrylate | LINCS |
| methyl grevillate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4510151 | ChemSpider |
| HMDB0061686 | HMDB |
| LSM-43038 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8140004 | Reaxys |
| CAS:63177-57-1 | ChemIDplus |
| Citations |
|---|