EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O5 |
| Net Charge | 0 |
| Average Mass | 190.195 |
| Monoisotopic Mass | 190.08412 |
| SMILES | O=C(O)CCCCC(=O)OCCO |
| InChI | InChI=1S/C8H14O5/c9-5-6-13-8(12)4-2-1-3-7(10)11/h9H,1-6H2,(H,10,11) |
| InChIKey | YXCHMHANQUUDOV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2-hydroxyethoxy)-6-oxohexanoic acid (CHEBI:84086) has functional parent adipic acid (CHEBI:30832) |
| 6-(2-hydroxyethoxy)-6-oxohexanoic acid (CHEBI:84086) has functional parent ethylene glycol (CHEBI:30742) |
| 6-(2-hydroxyethoxy)-6-oxohexanoic acid (CHEBI:84086) has role human urinary metabolite (CHEBI:84087) |
| 6-(2-hydroxyethoxy)-6-oxohexanoic acid (CHEBI:84086) is a dicarboxylic acid monoester (CHEBI:36244) |
| 6-(2-hydroxyethoxy)-6-oxohexanoic acid (CHEBI:84086) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| 6-(2-hydroxyethoxy)-6-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| (2-hydroxyethyl) hydrogen adipate | ChemIDplus |
| adipinic acid ethylene glycol monoester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1866477 | Reaxys |
| CAS:94109-19-0 | ChemIDplus |
| Citations |
|---|