EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H60O2 |
| Net Charge | 0 |
| Average Mass | 452.808 |
| Monoisotopic Mass | 452.45933 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCC |
| InChI | InChI=1S/C30H60O2/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30(31)32-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h3-29H2,1-2H3 |
| InChIKey | UULYVBBLIYLRCU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euglena gracilis (ncbitaxon:3039) | - | PubMed (20195781) | |
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | PubMed (15070765) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myristyl palmitate (CHEBI:84064) has functional parent tetradecan-1-ol (CHEBI:77417) |
| myristyl palmitate (CHEBI:84064) has role bacterial metabolite (CHEBI:76969) |
| myristyl palmitate (CHEBI:84064) has role fungal xenobiotic metabolite (CHEBI:76968) |
| myristyl palmitate (CHEBI:84064) is a hexadecanoate ester (CHEBI:25835) |
| myristyl palmitate (CHEBI:84064) is a wax ester (CHEBI:10036) |
| IUPAC Name |
|---|
| tetradecanyl hexadecanoate |
| Synonyms | Source |
|---|---|
| Hexadecanoic acid, tetradecyl ester | ChemIDplus |
| Palmitic acid, tetradecyl ester | NIST Chemistry WebBook |
| Tetradecyl palmitate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| tetradecyl hexadecanoate | UniProt |
| Citations |
|---|