EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N3O6 |
| Net Charge | 0 |
| Average Mass | 289.288 |
| Monoisotopic Mass | 289.12739 |
| SMILES | CC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-2-7(10(18)13-5-9(16)17)14-8(15)4-3-6(12)11(19)20/h6-7H,2-5,12H2,1H3,(H,13,18)(H,14,15)(H,16,17)(H,19,20)/t6-,7-/m0/s1 |
| InChIKey | JCMUOFQHZLPHQP-BQBZGAKWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1074/jbc.M601876200) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophthalmic acid (CHEBI:84058) has role biomarker (CHEBI:59163) |
| ophthalmic acid (CHEBI:84058) has role human metabolite (CHEBI:77746) |
| ophthalmic acid (CHEBI:84058) is a L-glutamine derivative (CHEBI:24317) |
| ophthalmic acid (CHEBI:84058) is conjugate acid of Ophthalmate (CHEBI:189750) |
| Incoming Relation(s) |
| Ophthalmate (CHEBI:189750) is conjugate base of ophthalmic acid (CHEBI:84058) |
| IUPAC Name |
|---|
| N-{(2S)-1-[(carboxymethyl)amino]-1-oxobutan-2-yl}-L-glutamine |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005765 | HMDB |
| Ophthalmic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1716274 | Reaxys |
| CAS:495-27-2 | ChemIDplus |
| Citations |
|---|