EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8405 - primaquine
| Formula | C15H21N3O |
| Net Charge | 0 |
| Average Mass | 259.353 |
| Monoisotopic Mass | 259.16846 |
| SMILES | COc1cc(NC(C)CCCN)c2ncccc2c1 |
| InChI | InChI=1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3 |
| InChIKey | INDBQLZJXZLFIT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primaquine (CHEBI:8405) has role antimalarial (CHEBI:38068) |
| primaquine (CHEBI:8405) is a N-substituted diamine (CHEBI:50441) |
| primaquine (CHEBI:8405) is a aminoquinoline (CHEBI:36709) |
| primaquine (CHEBI:8405) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| N4-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
| INNs | Source |
|---|---|
| primaquina | ChemIDplus |
| primaquine | KEGG DRUG |
| primaquinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-Methoxy-8-(4-amino-1-methylbutylamino)quinoline | ChemIDplus |
| 8-((4-Amino-1-methylbutyl)amino)-6-methoxyquinoline | NIST Chemistry WebBook |
| 8-(4-Amino-1-methylbutylamino)-6-methoxyquinoline | ChemIDplus |
| Neo-Quipenyl | DrugBank |
| Primachin | DrugBank |
| Primachinum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2266 | DrugCentral |
| C07627 | KEGG COMPOUND |
| D08420 | KEGG DRUG |
| DB01087 | DrugBank |
| HMDB0015219 | HMDB |
| LSM-1649 | LINCS |
| Primaquine | Wikipedia |
| Citations |
|---|