EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8405 - primaquine
| Formula | C15H21N3O |
| Net Charge | 0 |
| Average Mass | 259.353 |
| Monoisotopic Mass | 259.16846 |
| SMILES | COc1cc(NC(C)CCCN)c2ncccc2c1 |
| InChI | InChI=1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3 |
| InChIKey | INDBQLZJXZLFIT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiviral agent A substance that destroys or inhibits replication of viruses. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primaquine (CHEBI:8405) has role anti-obesity agent (CHEBI:74518) |
| primaquine (CHEBI:8405) has role antifungal agent (CHEBI:35718) |
| primaquine (CHEBI:8405) has role antimalarial (CHEBI:38068) |
| primaquine (CHEBI:8405) has role antiviral agent (CHEBI:22587) |
| primaquine (CHEBI:8405) is a N-substituted diamine (CHEBI:50441) |
| primaquine (CHEBI:8405) is a aminoquinoline (CHEBI:36709) |
| primaquine (CHEBI:8405) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| N4-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
| INNs | Source |
|---|---|
| primaquina | ChemIDplus |
| primaquine | KEGG DRUG |
| primaquinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-Methoxy-8-(4-amino-1-methylbutylamino)quinoline | ChemIDplus |
| 8-((4-Amino-1-methylbutyl)amino)-6-methoxyquinoline | NIST Chemistry WebBook |
| 8-(4-Amino-1-methylbutylamino)-6-methoxyquinoline | ChemIDplus |
| Kanaprim | ChEMBL |
| Maliride | ChEMBL |
| Neo-Quipenyl | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2266 | DrugCentral |
| C07627 | KEGG COMPOUND |
| D08420 | KEGG DRUG |
| DB01087 | DrugBank |
| HMDB0015219 | HMDB |
| LSM-1649 | LINCS |
| Primaquine | Wikipedia |
| Citations |
|---|