EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8404 - prilocaine
| Formula | C13H20N2O |
| Net Charge | 0 |
| Average Mass | 220.316 |
| Monoisotopic Mass | 220.15756 |
| SMILES | CCCNC(C)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C13H20N2O/c1-4-9-14-11(3)13(16)15-12-8-6-5-7-10(12)2/h5-8,11,14H,4,9H2,1-3H3,(H,15,16) |
| InChIKey | MVFGUOIZUNYYSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prilocaine (CHEBI:8404) has role anticonvulsant (CHEBI:35623) |
| prilocaine (CHEBI:8404) has role local anaesthetic (CHEBI:36333) |
| prilocaine (CHEBI:8404) is a amino acid amide (CHEBI:22475) |
| prilocaine (CHEBI:8404) is a monocarboxylic acid amide (CHEBI:29347) |
| Incoming Relation(s) |
| prilocaine hydrochloride (CHEBI:32053) has part prilocaine (CHEBI:8404) |
| IUPAC Name |
|---|
| N-(2-methylphenyl)-N2-propylalaninamide |
| INNs | Source |
|---|---|
| prilocaina | ChemIDplus |
| prilocainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Methyl-alpha-propylaminopropionanilide | ChemIDplus |
| 2-(Propylamino)-o-propionotoluidide | ChemIDplus |
| alpha-n-Propylamino-2-methylpropionanilide | ChemIDplus |
| N-(2-Methylphenyl)-2-(propylamino)propanamide | ChemIDplus |
| o-Methyl-2-propylaminopropionanilide | ChemIDplus |
| o-Methyl-alpha-propylaminopropionanilide | ChemIDplus |
| Citations |
|---|