EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H33NO9 |
| Net Charge | 0 |
| Average Mass | 563.603 |
| Monoisotopic Mass | 563.21553 |
| SMILES | C=Cc1cc(OC)c2c(c1)c(=O)oc1c2cc(OC)c2c(O)ccc(C3O[C@H](C)[C@H](OC(C)=O)[C@H](N(C)C)[C@H]3O)c21 |
| InChI | InChI=1S/C31H33NO9/c1-8-16-11-19-23(21(12-16)37-6)18-13-22(38-7)25-20(34)10-9-17(24(25)29(18)41-31(19)36)30-27(35)26(32(4)5)28(14(2)39-30)40-15(3)33/h8-14,26-28,30,34-35H,1H2,2-7H3/t14-,26-,27-,28+,30?/m1/s1 |
| InChIKey | GHLIFBNIGXVDHM-VQXSZRIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces ravidus (ncbitaxon:691266) | - | PubMed (20140934) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ravidomycin (CHEBI:84037) has role antimicrobial agent (CHEBI:33281) |
| ravidomycin (CHEBI:84037) has role antineoplastic agent (CHEBI:35610) |
| ravidomycin (CHEBI:84037) has role bacterial metabolite (CHEBI:76969) |
| ravidomycin (CHEBI:84037) is a C-glycosyl compound (CHEBI:20857) |
| ravidomycin (CHEBI:84037) is a acetate ester (CHEBI:47622) |
| ravidomycin (CHEBI:84037) is a aromatic ether (CHEBI:35618) |
| ravidomycin (CHEBI:84037) is a naphthoisochromene (CHEBI:50359) |
| ravidomycin (CHEBI:84037) is a olefinic compound (CHEBI:78840) |
| ravidomycin (CHEBI:84037) is a phenols (CHEBI:33853) |
| ravidomycin (CHEBI:84037) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| (1ξ)-4-O-acetyl-1,5-anhydro-3,6-dideoxy-3-(dimethylamino)-1-(1-hydroxy-10,12-dimethoxy-6-oxo-8-vinyl-6H-dibenzo[c,h]chromen-4-yl)-D-galactitol |
| Synonym | Source |
|---|---|
| AY 25545 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24732621 | Reaxys |
| CAS:74622-75-6 | ChemIDplus |
| Citations |
|---|