EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO3 |
| Net Charge | 0 |
| Average Mass | 263.337 |
| Monoisotopic Mass | 263.15214 |
| SMILES | C=C[C@H]1C[C@@H](C)C[C@@H](C)[C@@H]1c1c(O)ccn(O)c1=O |
| InChI | InChI=1S/C15H21NO3/c1-4-11-8-9(2)7-10(3)13(11)14-12(17)5-6-16(19)15(14)18/h4-6,9-11,13,17,19H,1,7-8H2,2-3H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | OQJADHLOEAOIGC-NOHGZBONSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. EC 3.4.24.24 (gelatinase A) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase A (EC 3.4.24.24). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxatin (CHEBI:84035) has role antimicrobial agent (CHEBI:33281) |
| pyridoxatin (CHEBI:84035) has role antineoplastic agent (CHEBI:35610) |
| pyridoxatin (CHEBI:84035) has role DNA synthesis inhibitor (CHEBI:59517) |
| pyridoxatin (CHEBI:84035) has role EC 3.4.24.24 (gelatinase A) inhibitor (CHEBI:84036) |
| pyridoxatin (CHEBI:84035) has role fungal metabolite (CHEBI:76946) |
| pyridoxatin (CHEBI:84035) has role radical scavenger (CHEBI:48578) |
| pyridoxatin (CHEBI:84035) is a dihydroxypyridine (CHEBI:23793) |
| pyridoxatin (CHEBI:84035) is a olefinic compound (CHEBI:78840) |
| pyridoxatin (CHEBI:84035) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 3-[(1S,2R,4S,6R)-6-ethenyl-2,4-dimethylcyclohexyl]-1,4-dihydroxypyridin-2(1H)-one |
| Synonyms | Source |
|---|---|
| Acremonium BX 86 factor | KNApSAcK |
| BX 86 | KNApSAcK |
| (-)-Pyridoxatin | KNApSAcK |
| Pyridoxatine | KNApSAcK |
| tolypocin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00017102 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6336633 | Reaxys |
| CAS:135529-30-5 | ChemIDplus |
| Citations |
|---|