EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO3 |
| Net Charge | 0 |
| Average Mass | 263.337 |
| Monoisotopic Mass | 263.15214 |
| SMILES | C=C[C@H]1C[C@@H](C)C[C@@H](C)[C@@H]1c1c(O)ccn(O)c1=O |
| InChI | InChI=1S/C15H21NO3/c1-4-11-8-9(2)7-10(3)13(11)14-12(17)5-6-16(19)15(14)18/h4-6,9-11,13,17,19H,1,7-8H2,2-3H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | OQJADHLOEAOIGC-NOHGZBONSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. EC 3.4.24.24 (gelatinase A) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase A (EC 3.4.24.24). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxatin (CHEBI:84035) has role antimicrobial agent (CHEBI:33281) |
| pyridoxatin (CHEBI:84035) has role antineoplastic agent (CHEBI:35610) |
| pyridoxatin (CHEBI:84035) has role DNA synthesis inhibitor (CHEBI:59517) |
| pyridoxatin (CHEBI:84035) has role EC 3.4.24.24 (gelatinase A) inhibitor (CHEBI:84036) |
| pyridoxatin (CHEBI:84035) has role fungal metabolite (CHEBI:76946) |
| pyridoxatin (CHEBI:84035) has role radical scavenger (CHEBI:48578) |
| pyridoxatin (CHEBI:84035) is a dihydroxypyridine (CHEBI:23793) |
| pyridoxatin (CHEBI:84035) is a olefinic compound (CHEBI:78840) |
| pyridoxatin (CHEBI:84035) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 3-[(1S,2R,4S,6R)-6-ethenyl-2,4-dimethylcyclohexyl]-1,4-dihydroxypyridin-2(1H)-one |
| Synonyms | Source |
|---|---|
| Acremonium BX 86 factor | KNApSAcK |
| BX 86 | KNApSAcK |
| (-)-Pyridoxatin | KNApSAcK |
| Pyridoxatine | KNApSAcK |
| tolypocin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00017102 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6336633 | Reaxys |
| CAS:135529-30-5 | ChemIDplus |
| Citations |
|---|