EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3 |
| Net Charge | -1 |
| Average Mass | 319.465 |
| Monoisotopic Mass | 319.22787 |
| SMILES | CCCCC/C=C\C/C=C\CC1OC1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-12-15-18-19(23-18)16-13-10-11-14-17-20(21)22/h6-7,9-10,12-13,18-19H,2-5,8,11,14-17H2,1H3,(H,21,22)/p-1/b7-6-,12-9-,13-10- |
| InChIKey | DBWQSCSXHFNTMO-TYAUOURKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,9-EET(1−) (CHEBI:84025) is a EET(1−) (CHEBI:131865) |
| 8,9-EET(1−) (CHEBI:84025) is a icosanoid anion (CHEBI:62937) |
| 8,9-EET(1−) (CHEBI:84025) is a long-chain fatty acid anion (CHEBI:57560) |
| 8,9-EET(1−) (CHEBI:84025) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 8,9-EET(1−) (CHEBI:84025) is conjugate base of 8,9-EET (CHEBI:34490) |
| Incoming Relation(s) |
| 8,9-epoxy-20-hydroxy-(5Z,11Z,14Z)-icosatrienoate (CHEBI:137474) has functional parent 8,9-EET(1−) (CHEBI:84025) |
| (8R,9S)-EET(1−) (CHEBI:131975) is a 8,9-EET(1−) (CHEBI:84025) |
| (8S,9R)-EET(1−) (CHEBI:131974) is a 8,9-EET(1−) (CHEBI:84025) |
| 8,9-EET (CHEBI:34490) is conjugate acid of 8,9-EET(1−) (CHEBI:84025) |
| IUPAC Name |
|---|
| (5Z)-7-{3-[(2Z,5Z)-undeca-2,5-dien-1-yl]oxiran-2-yl}hept-5-enoate |
| Synonyms | Source |
|---|---|
| 8,9-EpETrE(1−) | SUBMITTER |
| 8,9-epoxy-(5Z,11Z,14Z)-icosatrienoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 8,9-epoxy-(5Z,11Z,14Z)-eicosatrienoate | UniProt |