EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16ClN3O2 |
| Net Charge | 0 |
| Average Mass | 293.754 |
| Monoisotopic Mass | 293.09310 |
| SMILES | CC(C)(C)C(=O)[C@H](Oc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,13H,1-3H3/t13-/m0/s1 |
| InChIKey | WURBVZBTWMNKQT-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-triadimefon (CHEBI:84004) is a 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one (CHEBI:84002) |
| (S)-triadimefon (CHEBI:84004) is enantiomer of (R)-triadimefon (CHEBI:84003) |
| Incoming Relation(s) |
| triadimefon (CHEBI:9665) has part (S)-triadimefon (CHEBI:84004) |
| (R)-triadimefon (CHEBI:84003) is enantiomer of (S)-triadimefon (CHEBI:84004) |
| IUPAC Name |
|---|
| (1S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20863308 | Reaxys |
| CAS:89497-67-6 | ChemIDplus |