EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3 |
| Net Charge | -1 |
| Average Mass | 319.465 |
| Monoisotopic Mass | 319.22787 |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)[O-])CO |
| InChI | InChI=1S/C20H32O3/c1-16(10-6-12-18(3)14-20(22)23)8-5-9-17(2)11-7-13-19(4)15-21/h9-10,13-14,21H,5-8,11-12,15H2,1-4H3,(H,22,23)/p-1/b16-10+,17-9+,18-14+,19-13+ |
| InChIKey | ALVRYIMWRLMAGB-DBXJBYPCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E,10E,14E)-ω-hydroxygeranylgeranate (CHEBI:83954) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| (2E,6E,10E,14E)-ω-hydroxygeranylgeranate (CHEBI:83954) is a methyl-branched fatty acid anion (CHEBI:67013) |
| (2E,6E,10E,14E)-ω-hydroxygeranylgeranate (CHEBI:83954) is a ω-hydroxy-long-chain fatty acid anion (CHEBI:140992) |
| (2E,6E,10E,14E)-ω-hydroxygeranylgeranate (CHEBI:83954) is conjugate base of (2E,6E,10E,14E)-ω-hydroxygeranylgeranic acid (CHEBI:84977) |
| Incoming Relation(s) |
| (2E,6E,10E,14E)-ω-hydroxygeranylgeranic acid (CHEBI:84977) is conjugate acid of (2E,6E,10E,14E)-ω-hydroxygeranylgeranate (CHEBI:83954) |
| IUPAC Name |
|---|
| (2E,6E,10E,14E)-16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
| Synonym | Source |
|---|---|
| (2E,6E,10E,14E)-16-hydroxygeranylgeranate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E,6E,10E)-ω-hydroxy-geranylgeranate | UniProt |
| Citations |
|---|