EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O2 |
| Net Charge | -1 |
| Average Mass | 303.466 |
| Monoisotopic Mass | 303.23295 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)[O-] |
| InChI | InChI=1S/C20H32O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h9,11,13,15H,6-8,10,12,14H2,1-5H3,(H,21,22)/p-1/b17-11+,18-13+,19-15+ |
| InChIKey | SZNLKILVMCHHSD-OZFNKYQOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E,10E)-geranylgeranate (CHEBI:83952) is a methyl-branched fatty acid anion (CHEBI:67013) |
| (2E,6E,10E)-geranylgeranate (CHEBI:83952) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| (2E,6E,10E)-geranylgeranate (CHEBI:83952) is conjugate base of (2E,6E,10E)-geranylgeranic acid (CHEBI:84971) |
| Incoming Relation(s) |
| (2E,6E,10E)-geranylgeranic acid (CHEBI:84971) is conjugate acid of (2E,6E,10E)-geranylgeranate (CHEBI:83952) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
| UniProt Name | Source |
|---|---|
| (2E,6E,10E)-geranylgeranate | UniProt |
| Citations |
|---|