EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C57H91N9O14 |
| Net Charge | 0 |
| Average Mass | 1126.404 |
| Monoisotopic Mass | 1125.66855 |
| SMILES | CC[C@H](C)C1C(=O)N(C)[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N(C)[C@@H](C(C)C)C(=O)N[C@@H](Cc2ccc(OC)cc2)C(=O)O[C@H](C)C(=O)N2CCCC[C@H]2C(=O)N(C)[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(=O)O)C(=O)N1C |
| InChI | InChI=1S/C57H91N9O14/c1-18-34(9)47-49(70)58-30-42(67)62(13)45(32(5)6)50(71)59-39(28-37-23-25-38(79-17)26-24-37)57(78)80-36(11)52(73)66-27-21-20-22-40(66)53(74)63(14)46(33(7)8)51(72)60-44(31(3)4)55(76)61(12)41(29-43(68)69)54(75)65(16)48(35(10)19-2)56(77)64(47)15/h23-26,31-36,39-41,44-48H,18-22,27-30H2,1-17H3,(H,58,70)(H,59,71)(H,60,72)(H,68,69)/t34-,35-,36+,39-,40-,41-,44-,45-,46-,47-,48?/m0/s1 |
| InChIKey | WRIUTPDMSISMSW-RVQHATKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SDZ 90-215 (CHEBI:83950) has role fungal metabolite (CHEBI:76946) |
| SDZ 90-215 (CHEBI:83950) is a cyclodepsipeptide (CHEBI:35213) |
| SDZ 90-215 (CHEBI:83950) is a macrocycle (CHEBI:51026) |
| Synonyms | Source |
|---|---|
| Cyclopeptolide 1 | ChemIDplus |
| cyclo-Pec-MeVal-Val-MeAsp-MeIle-MeIle-Gly-MeVal-Tyr(Me)-R-Hypr | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6681692 | Reaxys |
| CAS:129816-38-2 | ChemIDplus |
| Citations |
|---|