EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13BN2O3S |
| Net Charge | 0 |
| Average Mass | 300.148 |
| Monoisotopic Mass | 300.07399 |
| SMILES | Cc1ccc(S(=O)(=O)N2N=Cc3ccccc3B2O)cc1 |
| InChI | InChI=1S/C14H13BN2O3S/c1-11-6-8-13(9-7-11)21(19,20)17-15(18)14-5-3-2-4-12(14)10-16-17/h2-10,18H,1H3 |
| InChIKey | UQIDNSKBUXCODH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diazaborine (CHEBI:83945) has role geroprotector (CHEBI:176497) |
| diazaborine (CHEBI:83945) is a organoboron compound (CHEBI:38278) |
| diazaborine (CHEBI:83945) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| diazaborine (CHEBI:83945) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| diazaborine derivative (CHEBI:83947) has functional parent diazaborine (CHEBI:83945) |
| IUPAC Name |
|---|
| 2-[(4-methylphenyl)sulfonyl]-2,3,1-benzodiazaborinin-1(2H)-ol |
| Manual Xrefs | Databases |
|---|---|
| 422598 | ChemSpider |
| CPD-22388 | MetaCyc |
| DB08265 | DrugBank |
| Diazaborine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:624363 | Reaxys |
| CAS:22959-81-5 | ChEBI |
| Citations |
|---|