EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CCC(O)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19) |
| InChIKey | KBDZCYDPGRYCRM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-hydroxypalmitic acid (CHEBI:83937) is a hydroxypalmitic acid (CHEBI:72726) |
| 14-hydroxypalmitic acid (CHEBI:83937) is conjugate acid of 14-hydroxypalmitate (CHEBI:83938) |
| Incoming Relation(s) |
| 14-hydroxypalmitate (CHEBI:83938) is conjugate base of 14-hydroxypalmitic acid (CHEBI:83937) |
| IUPAC Name |
|---|
| 14-hydroxyhexadecanoic acid |
| Synonym | Source |
|---|---|
| ω-2-hydroxypalmitic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10694504 | Reaxys |