EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CC(O)CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O3/c1-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19) |
| InChIKey | WQPQDBIUAFINBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-hydroxypalmitic acid (CHEBI:83935) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 15-hydroxypalmitic acid (CHEBI:83935) is a hydroxypalmitic acid (CHEBI:72726) |
| 15-hydroxypalmitic acid (CHEBI:83935) is conjugate acid of 15-hydroxypalmitate (CHEBI:83936) |
| Incoming Relation(s) |
| (15R)-15-hydroxypalmitic acid (CHEBI:78998) is a 15-hydroxypalmitic acid (CHEBI:83935) |
| 15-hydroxypalmitate (CHEBI:83936) is conjugate base of 15-hydroxypalmitic acid (CHEBI:83935) |
| IUPAC Name |
|---|
| 15-hydroxyhexadecanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1784472 | Reaxys |
| Citations |
|---|