EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H50O14 |
| Net Charge | 0 |
| Average Mass | 754.826 |
| Monoisotopic Mass | 754.32006 |
| SMILES | CC(=O)O[C@H](CCC[C@]12O[C@H](C(=O)O)[C@@](O)(C(=O)O)[C@](C(=O)O)(O1)[C@H](OC(=O)CC/C=C/[C@H](C)CCCc1ccccc1)[C@H]2O)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C40H50O14/c1-25(15-12-20-28-16-6-4-7-17-28)14-10-11-22-31(42)52-33-32(43)38(53-34(35(44)45)39(50,36(46)47)40(33,54-38)37(48)49)23-13-21-30(51-27(3)41)26(2)24-29-18-8-5-9-19-29/h4-10,14,16-19,25-26,30,32-34,43,50H,11-13,15,20-24H2,1-3H3,(H,44,45)(H,46,47)(H,48,49)/b14-10+/t25-,26+,30+,32+,33+,34+,38-,39+,40-/m0/s1 |
| InChIKey | KQMNJFMTGHRJHM-ZFSXNWTMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.5.1.21 (squalene synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of squalene synthase (EC 2.5.1.21). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaragozic acid C (CHEBI:83934) has role EC 2.5.1.21 (squalene synthase) inhibitor (CHEBI:75174) |
| zaragozic acid C (CHEBI:83934) has role fungal metabolite (CHEBI:76946) |
| zaragozic acid C (CHEBI:83934) is a acetate ester (CHEBI:47622) |
| zaragozic acid C (CHEBI:83934) is a cyclic ketal (CHEBI:59779) |
| zaragozic acid C (CHEBI:83934) is a oxabicycloalkane (CHEBI:46733) |
| zaragozic acid C (CHEBI:83934) is a polyketide (CHEBI:26188) |
| zaragozic acid C (CHEBI:83934) is a tertiary alcohol (CHEBI:26878) |
| zaragozic acid C (CHEBI:83934) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| (1S,3S,4S,5R,6R,7R)-1-[(4R,5R)-4-acetoxy-5-methyl-6-phenylhexyl]-4,7-dihydroxy-6-{[(4E,6R)-6-methyl-9-phenylnon-4-enoyl]oxy}-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| (+)-Zaragozic acid | ChemIDplus |
| L-697350 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-4585 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6839401 | Reaxys |
| CAS:146389-62-0 | ChemIDplus |
| Citations |
|---|