EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19ClO4 |
| Net Charge | 0 |
| Average Mass | 322.788 |
| Monoisotopic Mass | 322.09719 |
| SMILES | CO/C=C(C(=O)OC)\C(C)=C/C=C/c1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C17H19ClO4/c1-12(14(11-20-2)17(19)22-4)6-5-7-13-8-9-15(18)16(10-13)21-3/h5-11H,1-4H3/b7-5+,12-6-,14-11+ |
| InChIKey | ZDIQYKMDNQULMX-PJUQCDRASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Favolaschia tonkinensis (ncbitaxon:333979) | - | PubMed (20329738) | |
| Strobilurus tenacellus (ncbitaxon:41251) | - | PubMed (563391) | Strain: No.21602 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strobilurin B (CHEBI:83924) has role antifungal agent (CHEBI:35718) |
| strobilurin B (CHEBI:83924) has role fungal metabolite (CHEBI:76946) |
| strobilurin B (CHEBI:83924) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| strobilurin B (CHEBI:83924) is a enoate ester (CHEBI:51702) |
| strobilurin B (CHEBI:83924) is a enol ether (CHEBI:47985) |
| strobilurin B (CHEBI:83924) is a methoxyacrylate strobilurin antifungal agent (CHEBI:86484) |
| strobilurin B (CHEBI:83924) is a monochlorobenzenes (CHEBI:83403) |
| strobilurin B (CHEBI:83924) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| methyl (2E,3Z,5E)-6-(4-chloro-3-methoxyphenyl)-2-(methoxymethylene)-3-methylhexa-3,5-dienoate |
| Manual Xrefs | Databases |
|---|---|
| C00018155 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5285030 | Reaxys |
| CAS:65105-52-4 | ChemIDplus |
| Citations |
|---|