EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H33O3 |
| Net Charge | -1 |
| Average Mass | 285.448 |
| Monoisotopic Mass | 285.24352 |
| SMILES | CC(CO)CCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C17H34O3/c1-16(15-18)13-11-9-7-5-3-2-4-6-8-10-12-14-17(19)20/h16,18H,2-15H2,1H3,(H,19,20)/p-1 |
| InChIKey | ADEHZUFYJHOPKU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxy-15-methylpalmitate (CHEBI:83914) has functional parent isoheptadecanoate (CHEBI:70838) |
| ω-hydroxy-15-methylpalmitate (CHEBI:83914) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| ω-hydroxy-15-methylpalmitate (CHEBI:83914) is a methyl-branched fatty acid anion (CHEBI:67013) |
| ω-hydroxy-15-methylpalmitate (CHEBI:83914) is a ω-hydroxy-long-chain fatty acid anion (CHEBI:140992) |
| ω-hydroxy-15-methylpalmitate (CHEBI:83914) is conjugate base of ω-hydroxy-15-methylpalmitic acid (CHEBI:84939) |
| Incoming Relation(s) |
| ω-hydroxy-15-methylpalmitic acid (CHEBI:84939) is conjugate acid of ω-hydroxy-15-methylpalmitate (CHEBI:83914) |
| IUPAC Name |
|---|
| 16-hydroxy-15-methylhexadecanoate |
| Synonyms | Source |
|---|---|
| ω-hydroxyisoheptadecanoate(1−) | SUBMITTER |
| 16-hydroxy-15-methylpalmitate | ChEBI |
| ω-hydroxy-15-methylhexadecanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| ω-hydroxy-15-methyl-hexadecanoate | UniProt |
| Citations |
|---|