EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83849 - dalcochinin-8'-O-β-D-glucoside
| Formula | C29H34O12 |
| Net Charge | 0 |
| Average Mass | 574.579 |
| Monoisotopic Mass | 574.20503 |
| SMILES | [H][C@@]12COc3cc(OC)c(OC)cc3[C@]1([H])[C@@H](O)c1ccc3c(c1O2)C[C@H](C(=C)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O3 |
| InChI | InChI=1S/C29H34O12/c1-12(10-38-29-27(34)26(33)25(32)21(9-30)41-29)17-7-15-16(39-17)5-4-13-24(31)23-14-6-19(35-2)20(36-3)8-18(14)37-11-22(23)40-28(13)15/h4-6,8,17,21-27,29-34H,1,7,9-11H2,2-3H3/t17-,21-,22-,23+,24+,25-,26+,27-,29-/m1/s1 |
| InChIKey | YRUIPRJNLCHFCW-BZSZILPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dalbergia cochinchinensis (ncbitaxon:106130) | seed (BTO:0001226) | DOI (doi:10.1016/S0031-9422(98)00552-4) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) has role plant metabolite (CHEBI:76924) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) is a aromatic ether (CHEBI:35618) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) is a olefinic compound (CHEBI:78840) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) is a organic heteropentacyclic compound (CHEBI:38164) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) is a oxacycle (CHEBI:38104) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) is a secondary alcohol (CHEBI:35681) |
| dalcochinin-8'-O-β-D-glucoside (CHEBI:83849) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-[(2R,6R,6aR,12aS)-6-hydroxy-8,9-dimethoxy-1,2,6,6a,12,12a-hexahydrochromeno[3,4-b]furo[2,3-h]chromen-2-yl]prop-2-en-1-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Dalcochinin O-glucoside | KNApSAcK |