EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H50N8O6.2HCl |
| Net Charge | 0 |
| Average Mass | 811.812 |
| Monoisotopic Mass | 810.33869 |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc(-c2ccc(-c3ccc(-c4cnc([C@@H]5CCCN5C(=O)[C@@H](NC(=O)OC)C(C)C)n4)cc3)cc2)n1)C(C)C.Cl.Cl |
| InChI | InChI=1S/C40H50N8O6.2ClH/c1-23(2)33(45-39(51)53-5)37(49)47-19-7-9-31(47)35-41-21-29(43-35)27-15-11-25(12-16-27)26-13-17-28(18-14-26)30-22-42-36(44-30)32-10-8-20-48(32)38(50)34(24(3)4)46-40(52)54-6;;/h11-18,21-24,31-34H,7-10,19-20H2,1-6H3,(H,41,43)(H,42,44)(H,45,51)(H,46,52);2*1H/t31-,32-,33-,34-;;/m0../s1 |
| InChIKey | BVZLLUDATICXCI-JMSCDMLISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. nonstructural protein 5A inhibitor Any inhibitor of nonstructural protein 5A. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daclatasvir hydrochloride (CHEBI:83800) has part daclatasvir(2+) (CHEBI:83801) |
| daclatasvir hydrochloride (CHEBI:83800) has role antiviral drug (CHEBI:36044) |
| daclatasvir hydrochloride (CHEBI:83800) has role nonstructural protein 5A inhibitor (CHEBI:83799) |
| daclatasvir hydrochloride (CHEBI:83800) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| methyl [(2S)-1-{(2S)-2-[4-(4'-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}pyrrolidin-2-yl]-1H-imidazol-4-yl}biphenyl-4-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl}-3-methyl-1-oxobutan-2-yl]carbamate dihydrochloride |
| Synonyms | Source |
|---|---|
| BMS 790052-05 | ChemIDplus |
| BMS-790052-05 | ChemIDplus |
| Daclatasvir dihydrochloride | KEGG DRUG |
| Dimethyl N,N'-(biphenyl-4,4'-diylbis(1H-imidazole-5,2-diyl-((2S)-pyrrolidine-2,1- diyl)((1S)-1-(1-methylethyl)-2-oxoethane-2,1-diyl)))dicarbamate dihydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Daklinza | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10105 | KEGG DRUG |
| Daclatasvir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13072109 | Reaxys |
| CAS:1009119-65-6 | KEGG DRUG |
| CAS:1009119-65-6 | ChemIDplus |
| Citations |
|---|