EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27O8P.2Na |
| Net Charge | 0 |
| Average Mass | 484.393 |
| Monoisotopic Mass | 484.12389 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COP(=O)([O-])[O-])[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C.[Na+].[Na+] |
| InChI | InChI=1S/C21H29O8P.2Na/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19;;/h5,7,9,14-16,18,23,25H,3-4,6,8,10-11H2,1-2H3,(H2,26,27,28);;/q;2*+1/p-2/t14-,15-,16-,18+,19-,20-,21-;;/m0../s1 |
| InChIKey | VJZLQIPZNBPASX-OJJGEMKLSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-asthmatic agent Any compound that has anti-asthmatic effects. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antifibrotic agent Any agent which acts to reduce fibrosis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prednisolone sodium phosphate (CHEBI:8379) has part prednisolone phosphate(2−) (CHEBI:145706) |
| prednisolone sodium phosphate (CHEBI:8379) has role anti-allergic agent (CHEBI:50857) |
| prednisolone sodium phosphate (CHEBI:8379) has role anti-anaemic agent (CHEBI:75835) |
| prednisolone sodium phosphate (CHEBI:8379) has role anti-asthmatic agent (CHEBI:65023) |
| prednisolone sodium phosphate (CHEBI:8379) has role anti-inflammatory agent (CHEBI:67079) |
| prednisolone sodium phosphate (CHEBI:8379) has role antifibrotic agent (CHEBI:233423) |
| prednisolone sodium phosphate (CHEBI:8379) has role antineoplastic agent (CHEBI:35610) |
| prednisolone sodium phosphate (CHEBI:8379) has role glucocorticoid receptor agonist (CHEBI:63562) |
| prednisolone sodium phosphate (CHEBI:8379) has role immunosuppressive agent (CHEBI:35705) |
| prednisolone sodium phosphate (CHEBI:8379) has role ophthalmology drug (CHEBI:66981) |
| prednisolone sodium phosphate (CHEBI:8379) has role prodrug (CHEBI:50266) |
| prednisolone sodium phosphate (CHEBI:8379) is a glucocorticoid (CHEBI:24261) |
| prednisolone sodium phosphate (CHEBI:8379) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 11β,17-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl phosphate |
| Synonyms | Source |
|---|---|
| 11β,17α-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl phosphate disodium | ChEBI |
| disodium prednisolone 21-phosphate | ChEBI |
| NSC-759187 | ChEMBL |
| prednisolone 21-disodium phosphate | DrugBank |
| prednisolone 21-phosphate disodium | ChemIDplus |
| prednisolone disodium phosphate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Codelsol | ChemIDplus |
| Cortisate-20 | ChemIDplus |
| Hydeltrasol | ChemIDplus |
| Inflamase | ChemIDplus |
| Inflamase Forte | ChemIDplus |
| Inflamase mild | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4451 | DrugCentral |
| D00981 | KEGG DRUG |
| DBSALT000785 | DrugBank |
| MX2008015059 | Patent |
| Prednisolone_sodium_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4795229 | Reaxys |
| CAS:125-02-0 | ChemIDplus |
| Citations |
|---|