EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27O8P.2Na |
| Net Charge | 0 |
| Average Mass | 484.393 |
| Monoisotopic Mass | 484.12389 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COP(=O)([O-])[O-])[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C.[Na+].[Na+] |
| InChI | InChI=1S/C21H29O8P.2Na/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19;;/h5,7,9,14-16,18,23,25H,3-4,6,8,10-11H2,1-2H3,(H2,26,27,28);;/q;2*+1/p-2/t14-,15-,16-,18+,19-,20-,21-;;/m0../s1 |
| InChIKey | VJZLQIPZNBPASX-OJJGEMKLSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prednisolone sodium phosphate (CHEBI:8379) has part prednisolone phosphate(2−) (CHEBI:145706) |
| prednisolone sodium phosphate (CHEBI:8379) has role anti-allergic agent (CHEBI:50857) |
| prednisolone sodium phosphate (CHEBI:8379) has role anti-inflammatory agent (CHEBI:67079) |
| prednisolone sodium phosphate (CHEBI:8379) has role glucocorticoid receptor agonist (CHEBI:63562) |
| prednisolone sodium phosphate (CHEBI:8379) has role ophthalmology drug (CHEBI:66981) |
| prednisolone sodium phosphate (CHEBI:8379) has role prodrug (CHEBI:50266) |
| prednisolone sodium phosphate (CHEBI:8379) is a glucocorticoid (CHEBI:24261) |
| prednisolone sodium phosphate (CHEBI:8379) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 11β,17-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl phosphate |
| Synonyms | Source |
|---|---|
| 11β,17α-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl phosphate disodium | ChEBI |
| disodium prednisolone 21-phosphate | ChEBI |
| prednisolone 21-disodium phosphate | DrugBank |
| prednisolone 21-phosphate disodium | ChemIDplus |
| prednisolone disodium phosphate | ChemIDplus |
| prednisolone sodium phosphate | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Codelsol | ChemIDplus |
| Cortisate-20 | ChemIDplus |
| Hydeltrasol | ChemIDplus |
| Inflamase | ChemIDplus |
| Inflamase Forte | ChemIDplus |
| Metreton | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4451 | DrugCentral |
| D00981 | KEGG DRUG |
| DBSALT000785 | DrugBank |
| MX2008015059 | Patent |
| Prednisolone_sodium_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4795229 | Reaxys |
| CAS:125-02-0 | ChemIDplus |
| Citations |
|---|