EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N5O |
| Net Charge | 0 |
| Average Mass | 225.296 |
| Monoisotopic Mass | 225.15896 |
| SMILES | CCNc1nc(N[C@@H](C)CC)nc(OC)n1 |
| InChI | InChI=1S/C10H19N5O/c1-5-7(3)12-9-13-8(11-6-2)14-10(15-9)16-4/h7H,5-6H2,1-4H3,(H2,11,12,13,14,15)/t7-/m0/s1 |
| InChIKey | ZJMZZNVGNSWOOM-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-secbumeton (CHEBI:83788) is a N-(butan-2-yl)-N'-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine (CHEBI:83786) |
| (S)-secbumeton (CHEBI:83788) is enantiomer of (R)-secbumeton (CHEBI:83787) |
| Incoming Relation(s) |
| secbumeton (CHEBI:82228) has part (S)-secbumeton (CHEBI:83788) |
| (R)-secbumeton (CHEBI:83787) is enantiomer of (S)-secbumeton (CHEBI:83788) |
| IUPAC Name |
|---|
| N-[(2S)-butan-2-yl]-N'-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine |