EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H73O8P |
| Net Charge | 0 |
| Average Mass | 700.979 |
| Monoisotopic Mass | 700.50431 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H73O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40)45-35-37(36-46-48(42,43)44)47-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37H,3-16,21-36H2,1-2H3,(H2,42,43,44)/b19-17-,20-18-/t37-/m1/s1 |
| InChIKey | MHUWZNTUIIFHAS-DSSVUWSHSA-N |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dioleoyl-sn-glycerol-3-phosphate (CHEBI:83775) is a 1-acyl-2-oleoyl-sn-glycero-3-phosphate (CHEBI:75109) |
| 1,2-dioleoyl-sn-glycerol-3-phosphate (CHEBI:83775) is a dioleoyl phosphatidic acid (CHEBI:60427) |
| 1,2-dioleoyl-sn-glycerol-3-phosphate (CHEBI:83775) is conjugate acid of 1,2-dioleoyl-sn-glycero-3-phosphate(2−) (CHEBI:74546) |
| Incoming Relation(s) |
| 1,2-dioleoyl-sn-glycero-3-phosphate(2−) (CHEBI:74546) is conjugate base of 1,2-dioleoyl-sn-glycerol-3-phosphate (CHEBI:83775) |
| IUPAC Name |
|---|
| (2R)-3-(phosphonooxy)propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| 1-18:1-2-18:1-phosphatidic acid | MetaCyc |
| 1,2-di-(9Z-octadecenoyl)-sn-glycero-3-phosphate | LIPID MAPS |
| PA(18:1/18:1) | LIPID MAPS |
| PA(18:1(9Z)/18:1(9Z)) | LIPID MAPS |
| PA(18:1n9/18:1n9) | HMDB |
| PA(18:1ω9/18:1ω9) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-8268 | MetaCyc |
| HMDB0007865 | HMDB |
| LMGP10010962 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1718367 | Reaxys |