EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O5S |
| Net Charge | 0 |
| Average Mass | 286.349 |
| Monoisotopic Mass | 286.08749 |
| SMILES | [H][C@]1(OCC)Oc2ccc(OS(C)(=O)=O)cc2C1(C)C |
| InChI | InChI=1S/C13H18O5S/c1-5-16-12-13(2,3)10-8-9(18-19(4,14)15)6-7-11(10)17-12/h6-8,12H,5H2,1-4H3/t12-/m0/s1 |
| InChIKey | IRCMYGHHKLLGHV-LBPRGKRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-ethofumesate (CHEBI:83769) is a 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate (CHEBI:83768) |
| (S)-ethofumesate (CHEBI:83769) is enantiomer of (R)-ethofumesate (CHEBI:83770) |
| Incoming Relation(s) |
| ethofumesate (CHEBI:81990) has part (S)-ethofumesate (CHEBI:83769) |
| (R)-ethofumesate (CHEBI:83770) is enantiomer of (S)-ethofumesate (CHEBI:83769) |
| IUPAC Name |
|---|
| (2S)-2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22877082 | Reaxys |