EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23FN4O3 |
| Net Charge | 0 |
| Average Mass | 434.471 |
| Monoisotopic Mass | 434.17542 |
| SMILES | O=C(c1cc(Cc2nnc(=O)c3ccccc23)ccc1F)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C24H23FN4O3/c25-20-8-5-15(14-21-17-3-1-2-4-18(17)22(30)27-26-21)13-19(20)24(32)29-11-9-28(10-12-29)23(31)16-6-7-16/h1-5,8,13,16H,6-7,9-12,14H2,(H,27,30) |
| InChIKey | FDLYAMZZIXQODN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olaparib (CHEBI:83766) has role antihypertensive agent (CHEBI:35674) |
| olaparib (CHEBI:83766) has role antineoplastic agent (CHEBI:35610) |
| olaparib (CHEBI:83766) has role apoptosis inducer (CHEBI:68495) |
| olaparib (CHEBI:83766) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| olaparib (CHEBI:83766) is a N-acylpiperazine (CHEBI:46844) |
| olaparib (CHEBI:83766) is a cyclopropanes (CHEBI:51454) |
| olaparib (CHEBI:83766) is a monofluorobenzenes (CHEBI:83575) |
| olaparib (CHEBI:83766) is a phthalazines (CHEBI:38768) |
| IUPAC Name |
|---|
| 4-(3-{[4-(cyclopropylcarbonyl)piperazin-1-yl]carbonyl}-4-fluorobenzyl)phthalazin-1(2H)-one |
| INN | Source |
|---|---|
| olaparib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| AZ-2281 | ChEMBL |
| AZ2281 | ChEMBL |
| AZD-2281 | SUBMITTER |
| AZD2281 | SUBMITTER |
| KU-0059436 | ChEMBL |
| KU-59436 | ChEMBL |
| Brand Name | Source |
|---|---|
| Lynparza | SUBMITTER |
| Citations |
|---|