EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17ClN4 |
| Net Charge | 0 |
| Average Mass | 288.782 |
| Monoisotopic Mass | 288.11417 |
| SMILES | CCCC[C@](C#N)(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN4/c1-2-3-8-15(9-17,10-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,2-3,8,10H2,1H3/t15-/m0/s1 |
| InChIKey | HZJKXKUJVSEEFU-HNNXBMFYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-myclobutanil (CHEBI:83730) is a 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile (CHEBI:83729) |
| (R)-myclobutanil (CHEBI:83730) is enantiomer of (S)-myclobutanil (CHEBI:83731) |
| Incoming Relation(s) |
| myclobutanil (CHEBI:75281) has part (R)-myclobutanil (CHEBI:83730) |
| (S)-myclobutanil (CHEBI:83731) is enantiomer of (R)-myclobutanil (CHEBI:83730) |
| IUPAC Name |
|---|
| (2R)-2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile |
| Synonyms | Source |
|---|---|
| (R)-(+)-myclobutanil | ChEBI |
| (+)-myclobutanil | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24694089 | Reaxys |
| Citations |
|---|