EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17ClN2O2 |
| Net Charge | 0 |
| Average Mass | 292.766 |
| Monoisotopic Mass | 292.09786 |
| SMILES | CC(C)(C)C(=O)[C@H](Oc1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-15(2,3)13(19)14(18-9-8-17-10-18)20-12-6-4-11(16)5-7-12/h4-10,14H,1-3H3/t14-/m0/s1 |
| InChIKey | OWEGWHBOCFMBLP-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-climbazole (CHEBI:83722) is a 1-(4-chlorophenoxy)-1-(1H-imidazol-1-yl)-3,3-dimethylbutan-2-one (CHEBI:83719) |
| (S)-climbazole (CHEBI:83722) is enantiomer of (R)-climbazole (CHEBI:83720) |
| Incoming Relation(s) |
| climbazole (CHEBI:83499) has part (S)-climbazole (CHEBI:83722) |
| (R)-climbazole (CHEBI:83720) is enantiomer of (S)-climbazole (CHEBI:83722) |
| IUPAC Name |
|---|
| (1S)-1-(4-chlorophenoxy)-1-(1H-imidazol-1-yl)-3,3-dimethylbutan-2-one |