EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17Cl2N3O |
| Net Charge | 0 |
| Average Mass | 314.216 |
| Monoisotopic Mass | 313.07487 |
| SMILES | CCCC[C@@](O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16/h4-5,7,9-10,20H,2-3,6,8H2,1H3/t14-/m1/s1 |
| InChIKey | STMIIPIFODONDC-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-hexaconazole (CHEBI:83713) is a 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol (CHEBI:83711) |
| (S)-hexaconazole (CHEBI:83713) is enantiomer of (R)-hexaconazole (CHEBI:83712) |
| Incoming Relation(s) |
| hexaconazole (CHEBI:81766) has part (S)-hexaconazole (CHEBI:83713) |
| (R)-hexaconazole (CHEBI:83712) is enantiomer of (S)-hexaconazole (CHEBI:83713) |
| IUPAC Name |
|---|
| (2S)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
| Citations |
|---|