EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13F2N3O |
| Net Charge | 0 |
| Average Mass | 301.296 |
| Monoisotopic Mass | 301.10267 |
| SMILES | O[C@@](Cn1cncn1)(c1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C16H13F2N3O/c17-13-7-5-12(6-8-13)16(22,9-21-11-19-10-20-21)14-3-1-2-4-15(14)18/h1-8,10-11,22H,9H2/t16-/m0/s1 |
| InChIKey | JWUCHKBSVLQQCO-INIZCTEOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-flutriafol (CHEBI:83709) is a 1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol (CHEBI:83707) |
| (S)-flutriafol (CHEBI:83709) is enantiomer of (R)-flutriafol (CHEBI:83708) |
| Incoming Relation(s) |
| flutriafol (CHEBI:81923) has part (S)-flutriafol (CHEBI:83709) |
| (R)-flutriafol (CHEBI:83708) is enantiomer of (S)-flutriafol (CHEBI:83709) |
| IUPAC Name |
|---|
| (1S)-1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol |
| Synonyms | Source |
|---|---|
| (+)-flutriafol | ChEBI |
| (S)-(+)-flutriafol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3115 | PPDB |
| Citations |
|---|