EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H29NO2 |
| Net Charge | 0 |
| Average Mass | 243.391 |
| Monoisotopic Mass | 243.21983 |
| SMILES | CCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)13(15)12-16/h10-11,13-14,16-17H,2-9,12,15H2,1H3/b11-10+/t13-,14+/m0/s1 |
| InChIKey | VDRZDTXJMRRVMF-NXFSIWHZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradecasphingosine (CHEBI:83706) is a aminodiol (CHEBI:22501) |
| tetradecasphingosine (CHEBI:83706) is a sphingoid (CHEBI:35785) |
| tetradecasphingosine (CHEBI:83706) is conjugate base of tetradecasphingosine(1+) (CHEBI:82878) |
| Incoming Relation(s) |
| N-(docosenoyl)-β-D-galactosyl-C14-sphingosine (CHEBI:136375) has functional parent tetradecasphingosine (CHEBI:83706) |
| N-acyltetradecasphing-4-enine (CHEBI:82876) has functional parent tetradecasphingosine (CHEBI:83706) |
| N-acyltetradecasphingosine-1-phosphocholine (CHEBI:82890) has functional parent tetradecasphingosine (CHEBI:83706) |
| N-acyltetradecasphingosine-1-phosphoethanolamine (CHEBI:83764) has functional parent tetradecasphingosine (CHEBI:83706) |
| N-acyltetradecasphingosine-1-phosphoethanolamine zwitterion (CHEBI:82905) has functional parent tetradecasphingosine (CHEBI:83706) |
| β-D-glucosyl-(1↔1')-N-acyltetradecasphingosine (CHEBI:83180) has functional parent tetradecasphingosine (CHEBI:83706) |
| tetradecasphingosine(1+) (CHEBI:82878) is conjugate acid of tetradecasphingosine (CHEBI:83706) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-aminotetradec-4-ene-1,3-diol |
| Synonyms | Source |
|---|---|
| C14-sphingosine | ChEBI |
| tetradecasphing-4-enine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21614871 | Reaxys |