EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15Cl3N2OS |
| Net Charge | 0 |
| Average Mass | 437.779 |
| Monoisotopic Mass | 435.99707 |
| SMILES | Clc1ccc([C@H](Cn2ccnc2)OCc2csc3c(Cl)cccc23)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl3N2OS/c21-14-4-5-16(18(23)8-14)19(9-25-7-6-24-12-25)26-10-13-11-27-20-15(13)2-1-3-17(20)22/h1-8,11-12,19H,9-10H2/t19-/m0/s1 |
| InChIKey | JLGKQTAYUIMGRK-IBGZPJMESA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arasertaconazole (CHEBI:83685) has role antibacterial drug (CHEBI:36047) |
| arasertaconazole (CHEBI:83685) has role antipruritic drug (CHEBI:59683) |
| arasertaconazole (CHEBI:83685) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| arasertaconazole (CHEBI:83685) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| arasertaconazole (CHEBI:83685) is a 1-{2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl}imidazole (CHEBI:83682) |
| arasertaconazole (CHEBI:83685) is a conazole antifungal drug (CHEBI:87071) |
| arasertaconazole (CHEBI:83685) is a imidazole antifungal drug (CHEBI:87069) |
| arasertaconazole (CHEBI:83685) is conjugate base of arasertaconazole(1+) (CHEBI:83699) |
| arasertaconazole (CHEBI:83685) is enantiomer of (S)-sertaconazole (CHEBI:83684) |
| Incoming Relation(s) |
| sertaconazole (CHEBI:82866) has part arasertaconazole (CHEBI:83685) |
| arasertaconazole(1+) (CHEBI:83699) is conjugate acid of arasertaconazole (CHEBI:83685) |
| (S)-sertaconazole (CHEBI:83684) is enantiomer of arasertaconazole (CHEBI:83685) |
| IUPAC Name |
|---|
| 1-[(2R)-2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole |
| INNs | Source |
|---|---|
| arasertaconazol | WHO MedNet |
| arasertaconazole | ChemIDplus |
| arasertaconazole | WHO MedNet |
| arasertaconazolum | WHO MedNet |
| Synonym | Source |
|---|---|
| (R)-sertaconazole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP2436374 | Patent |
| WO2012041966 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11333066 | Reaxys |
| CAS:583057-48-1 | ChemIDplus |