EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO5S |
| Net Charge | 0 |
| Average Mass | 329.418 |
| Monoisotopic Mass | 329.12969 |
| SMILES | CCc1cccc(C)c1N(C(=O)CS(=O)(=O)O)[C@H](C)COC |
| InChI | InChI=1S/C15H23NO5S/c1-5-13-8-6-7-11(2)15(13)16(12(3)9-21-4)14(17)10-22(18,19)20/h6-8,12H,5,9-10H2,1-4H3,(H,18,19,20)/t12-/m1/s1 |
| InChIKey | CIGKZVUEZXGYSV-GFCCVEGCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-metolachlor ESA (CHEBI:83680) is a 2-[(2-ethyl-6-methylphenyl)(1-methoxypropan-2-yl)amino]-2-oxoethanesulfonic acid (CHEBI:83679) |
| (R)-metolachlor ESA (CHEBI:83680) is enantiomer of (S)-metolachlor ESA (CHEBI:83681) |
| Incoming Relation(s) |
| metolachlor ESA (CHEBI:83472) has part (R)-metolachlor ESA (CHEBI:83680) |
| (S)-metolachlor ESA (CHEBI:83681) is enantiomer of (R)-metolachlor ESA (CHEBI:83680) |
| IUPAC Name |
|---|
| 2-{(2-ethyl-6-methylphenyl)[(2R)-1-methoxypropan-2-yl]amino}-2-oxoethanesulfonic acid |