EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O2 |
| Net Charge | 0 |
| Average Mass | 190.242 |
| Monoisotopic Mass | 190.09938 |
| SMILES | COc1ccc2c(c1)OC(C)(C)C=C2 |
| InChI | InChI=1S/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
| InChIKey | CPTJXGLQLVPIGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precocene I (CHEBI:8368) has role plant metabolite (CHEBI:76924) |
| precocene I (CHEBI:8368) has role precocenes (CHEBI:26220) |
| precocene I (CHEBI:8368) is a aromatic ether (CHEBI:35618) |
| precocene I (CHEBI:8368) is a chromenes (CHEBI:23232) |
| IUPAC Name |
|---|
| 7-methoxy-2,2-dimethyl-2H-chromene |
| Synonyms | Source |
|---|---|
| 2,2-dimethyl-2H-chromen-7-yl methyl ether | NIST Chemistry WebBook |
| 2,2-dimethyl-7-methoxy-2H-1-benzopyran | NIST Chemistry WebBook |
| 6-demethoxyageratochromene | ChemIDplus |
| 7-methoxy-2,2-dimethylchromene | NIST Chemistry WebBook |
| Precocene 1 | KEGG COMPOUND |
| Precocene I | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:133917 | Reaxys |
| CAS:17598-02-6 | KEGG COMPOUND |
| CAS:17598-02-6 | NIST Chemistry WebBook |
| CAS:17598-02-6 | ChemIDplus |
| Citations |
|---|