EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H65O4 |
| Net Charge | -1 |
| Average Mass | 537.890 |
| Monoisotopic Mass | 537.48883 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(CCCCCCCCC)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C34H66O4/c1-3-5-7-9-11-12-13-14-15-16-18-23-27-31-34(37)38-32(28-24-20-17-10-8-6-4-2)29-25-21-19-22-26-30-33(35)36/h32H,3-31H2,1-2H3,(H,35,36)/p-1 |
| InChIKey | MHQWHZLXDBVXML-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-PAHSA(1−) (CHEBI:83670) has role anti-inflammatory agent (CHEBI:67079) |
| 9-PAHSA(1−) (CHEBI:83670) has role human metabolite (CHEBI:77746) |
| 9-PAHSA(1−) (CHEBI:83670) has role hypoglycemic agent (CHEBI:35526) |
| 9-PAHSA(1−) (CHEBI:83670) is a FAHFA anion (CHEBI:197342) |
| 9-PAHSA(1−) (CHEBI:83670) is a long-chain fatty acid anion (CHEBI:57560) |
| 9-PAHSA(1−) (CHEBI:83670) is conjugate base of 9-PAHSA (CHEBI:84425) |
| Incoming Relation(s) |
| 9-PAHSA (CHEBI:84425) is conjugate acid of 9-PAHSA(1−) (CHEBI:83670) |
| IUPAC Name |
|---|
| 9-(hexadecanoyloxy)octadecanoate |
| Synonyms | Source |
|---|---|
| 9-(palmitoyloxy)octadecanoate | IUPAC |
| 9-(palmitoyloxy)stearate | ChEBI |
| palmitoyl-9-hydroxystearate ester(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 9-hexadecanoyloxy-octadecanoate | UniProt |
| Citations |
|---|