EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25ClN2O2 |
| Net Charge | 0 |
| Average Mass | 384.907 |
| Monoisotopic Mass | 384.16046 |
| SMILES | [H]C(C(=O)N1CCOCC1)=C(c1ccc(C(C)(C)C)cc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-22(2,3)18-7-4-16(5-8-18)19(17-6-9-20(23)24-15-17)14-21(26)25-10-12-27-13-11-25/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | BAUQXSYUDSNRHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrimorph (CHEBI:83663) has role fungicide (CHEBI:24127) |
| pyrimorph (CHEBI:83663) is a chloropyridine (CHEBI:39173) |
| pyrimorph (CHEBI:83663) is a enamide (CHEBI:51751) |
| pyrimorph (CHEBI:83663) is a morpholines (CHEBI:38785) |
| pyrimorph (CHEBI:83663) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 3-(4-tert-butylphenyl)-3-(6-chloropyridin-3-yl)-1-(morpholin-4-yl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 3-(p-tert-butylphenyl)-3-(6-chloropyridin-3-yl)-1-(morpholin-4-yl)prop-2-en-1-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:868390-90-3 | ChEBI |
| Citations |
|---|