EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83656 - luminespib
| Formula | C26H31N3O5 |
| Net Charge | 0 |
| Average Mass | 465.550 |
| Monoisotopic Mass | 465.22637 |
| SMILES | CCNC(=O)c1noc(-c2cc(C(C)C)c(O)cc2O)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-4-27-26(32)24-23(18-7-5-17(6-8-18)15-29-9-11-33-12-10-29)25(34-28-24)20-13-19(16(2)3)21(30)14-22(20)31/h5-8,13-14,16,30-31H,4,9-12,15H2,1-3H3,(H,27,32) |
| InChIKey | NDAZATDQFDPQBD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luminespib (CHEBI:83656) has role angiogenesis inhibitor (CHEBI:48422) |
| luminespib (CHEBI:83656) has role antineoplastic agent (CHEBI:35610) |
| luminespib (CHEBI:83656) has role Hsp90 inhibitor (CHEBI:63962) |
| luminespib (CHEBI:83656) is a aromatic amide (CHEBI:62733) |
| luminespib (CHEBI:83656) is a isoxazoles (CHEBI:55373) |
| luminespib (CHEBI:83656) is a monocarboxylic acid amide (CHEBI:29347) |
| luminespib (CHEBI:83656) is a morpholines (CHEBI:38785) |
| luminespib (CHEBI:83656) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 5-(2,4-dihydroxy-5-isopropylphenyl)-N-ethyl-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
| Synonym | Source |
|---|---|
| NVP-AUY922 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NVP-AUY922 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12046798 | Reaxys |
| CAS:747412-49-3 | ChemIDplus |
| Citations |
|---|