EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO4 |
| Net Charge | 0 |
| Average Mass | 279.336 |
| Monoisotopic Mass | 279.14706 |
| SMILES | CCc1cccc(C)c1N(C(=O)C(=O)O)[C@H](C)COC |
| InChI | InChI=1S/C15H21NO4/c1-5-12-8-6-7-10(2)13(12)16(11(3)9-20-4)14(17)15(18)19/h6-8,11H,5,9H2,1-4H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | LNOOSYCKMKZOJB-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-metolachlor OXA (CHEBI:83653) is a [(2-ethyl-6-methylphenyl)(1-methoxypropan-2-yl)amino](oxo)acetic acid (CHEBI:83652) |
| (R)-metolachlor OXA (CHEBI:83653) is enantiomer of (S)-metolachlor OXA (CHEBI:83655) |
| Incoming Relation(s) |
| metolachlor OXA (CHEBI:83462) has part (R)-metolachlor OXA (CHEBI:83653) |
| (S)-metolachlor OXA (CHEBI:83655) is enantiomer of (R)-metolachlor OXA (CHEBI:83653) |
| IUPAC Name |
|---|
| {(2-ethyl-6-methylphenyl)[(2R)-1-methoxypropan-2-yl]amino}(oxo)acetic acid |