EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18ClNO2S |
| Net Charge | 0 |
| Average Mass | 275.801 |
| Monoisotopic Mass | 275.07468 |
| SMILES | COC[C@@H](C)N(C(=O)CCl)c1c(C)csc1C |
| InChI | InChI=1S/C12H18ClNO2S/c1-8-7-17-10(3)12(8)14(11(15)5-13)9(2)6-16-4/h7,9H,5-6H2,1-4H3/t9-/m1/s1 |
| InChIKey | JLYFCTQDENRSOL-SECBINFHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-dimethenamid (CHEBI:83639) is a 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-(1-methoxypropan-2-yl)acetamide (CHEBI:83638) |
| (R)-dimethenamid (CHEBI:83639) is enantiomer of dimethenamid-P (CHEBI:83640) |
| Incoming Relation(s) |
| dimethenamid (CHEBI:81789) has part (R)-dimethenamid (CHEBI:83639) |
| dimethenamid-P (CHEBI:83640) is enantiomer of (R)-dimethenamid (CHEBI:83639) |
| IUPAC Name |
|---|
| 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[(2R)-1-methoxypropan-2-yl]acetamide |
| Synonym | Source |
|---|---|
| (−)-dimethenamid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8319838 | Reaxys |
| CAS:163515-13-7 | ChEBI |