EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O5 |
| Net Charge | 0 |
| Average Mass | 240.215 |
| Monoisotopic Mass | 240.07462 |
| SMILES | CC[C@@H](C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3/t6-/m1/s1 |
| InChIKey | OWZPCEFYPSAJFR-ZCFIWIBFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-dinoseb (CHEBI:83633) is a 2-(butan-2-yl)-4,6-dinitrophenol (CHEBI:83632) |
| (R)-dinoseb (CHEBI:83633) is enantiomer of (S)-dinoseb (CHEBI:83636) |
| Incoming Relation(s) |
| dinoseb (CHEBI:34719) has part (R)-dinoseb (CHEBI:83633) |
| (S)-dinoseb (CHEBI:83636) is enantiomer of (R)-dinoseb (CHEBI:83633) |
| IUPAC Name |
|---|
| 2-[(2R)-butan-2-yl]-4,6-dinitrophenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3211810 | Reaxys |